@article {7272, title = {SYNTHESIS, CHARACTERIZATION AND REACTIVITY OF SOME MONONUCLEAR AND DINUCLEAR CHLORORUTHENIUM COMPLEXES CONTAINING CHELATING DITERTIARY PHOSPHINES (P-P) WITH P-PRU = 1}, journal = {Inorganica Chimica Acta}, volume = {198}, year = {1992}, note = {ISI Document Delivery No.: JK243Times Cited: 72Cited Reference Count: 92}, month = {Aug-Oct}, pages = {283-296}, type = {Article}, abstract = {{Mixed-valence complexes of the type (P-P)ClRu(mu-Cl)3RuCl(P-P), and the [RuCl(P-P)]2(mu-Cl)2 products formed by their reduction with H2, are synthesized, where P-P is a chelating ditertiary phosphine Ph2P(CH2)nPPh2 (n = 3-6) or some related chiral analogues such as diop, chiraphos, dppcp, dpcycp, bdpp, binap, phenop or norphos (diop = Ph2PCH2CHOCMe2OCHCH2PPh2; chiraphos = Ph2PCH(Me)CH(Me)PPh2; dppcp = Ph2PCH(CH2)3CHPPh2; dpcycp = (C6H11)2PCH(CH2)3CHP(C6H11)2; bdpp(skewphos) = Ph2PCH(Me)CH2CH(Me)PPh2; binap = 2,2{\textquoteright}-bis(diphenylphosphine)-1,1{\textquoteright}-binaphthyl; phenop = Ph2PN(Et)CH(CH2Ph)CH2OPPh2; norphos = Ph2PCHCHCH=CHCH(CH2)CHPPh2). The [RuCl(binap)]2(mu-Cl)2 species is also formed in solution by dissociation of PPh3 from RuCl2(binap)(PPh3) which is synthesized by phosphine exchange with RuCl2(PPh3)3. From the [RuCl(P-P)]2(mu-Cl)2 complex (P-P = Ph2P(CH2)4PPh2), a range of L(P-P)Ru(mu-Cl)3RuCl(P-P) species is readily formed, where L includes an amine, acetone, NN-dimethylacetamide, Mel, PhCN, CO, N2 or H2; the L = NEt3 adduct is made also from RUCl2(dppb)(PPh3), while the corresponding dimethyl sulfoxide adduct (L = DMSO), 17e, is synthesized directly from cis-RuCl2(DMSO)4 and the phosphine. P-31{H-1} NMR data are presented for the Ru(II) species, while characterization of 17e includes an X-ray_crystallographic analysis that confirms the trichloro-bridged formulation. Crystal data are as follows: triclinic, P1BAR}, keywords = {1{\textquoteright}-BINAPHTHYL, 2, 2{\textquoteright}-BIS(DIPHENYLPHOSPHINO)-1, ASYMMETRIC HYDROGENATION, BINAP-RUTHENIUM(II) COMPLEXES, CATALYSTS, COMPLEXES, CRYSTAL-STRUCTURE, DICARBOXYLATE, MECHANISM, ROUTE, RUTHENIUM(II) COMPLEXES, UNSATURATED CARBOXYLIC-ACIDS}, isbn = {0020-1693}, url = {://A1992JK24300031}, author = {Joshi, A. M. and Thorburn, I. S. and Rettig, S. J. and James, Brian R.} }